C25H22FN3O3 — CID 78890740
N-[(2-fluorophenyl)methyl]-4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzamide (PubChem CID 78890740) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 78890740 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)Nc3ccc(C(=O)NCc4ccccc4F)cc3)c2c1 |
| InChI | InChI=1S/C25H22FN3O3/c1-32-20-10-11-23-21(13-20)18(15-27-23)12-24(30)29-19-8-6-16(7-9-19)25(31)28-14-17-4-2-3-5-22(17)26/h2-11,13,15,27H,12,14H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | DSZWCBUMSQHZAW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |