C17H31F3N4OS — CID 78891481
1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea (PubChem CID 78891481) has the molecular formula C17H31F3N4OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea.
| Compound Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 78891481 |
| Molecular Formula | C17H31F3N4OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
| SMILES | CN(CCCNC(=O)NCC1(N2CCSCC2)CCCC1)CC(F)(F)F |
| InChI | InChI=1S/C17H31F3N4OS/c1-23(14-17(18,19)20)8-4-7-21-15(25)22-13-16(5-2-3-6-16)24-9-11-26-12-10-24/h2-14H2,1H3,(H2,21,22,25) |
| InChIKey | UEBQNRKOAZPGEZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|