C22H21N3O3S — CID 78892145
2-benzyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 78892145) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-benzyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 78892145 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-benzyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C1CCc2cc(OCCNC(=O)c3csc(Cc4ccccc4)n3)ccc2N1 |
| InChI | InChI=1S/C22H21N3O3S/c26-20-9-6-16-13-17(7-8-18(16)24-20)28-11-10-23-22(27)19-14-29-21(25-19)12-15-4-2-1-3-5-15/h1-5,7-8,13-14H,6,9-12H2,(H,23,27)(H,24,26) |
| InChIKey | QAANMDKIPYDIEM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|