C18H13F3N4O3S — CID 78893123
4-(2,4-difluoro-5-nitrophenyl)-N-(3-fluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 78893123) has the molecular formula C18H13F3N4O3S and a molecular weight of 422.39 g/mol. Its IUPAC name is 4-(2,4-difluoro-5-nitrophenyl)-N-(3-fluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(2,4-difluoro-5-nitrophenyl)-N-(3-fluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 78893123 |
| Molecular Formula | C18H13F3N4O3S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-(2,4-difluoro-5-nitrophenyl)-N-(3-fluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(F)c2)C(c2cc([N+](=O)[O-])c(F)cc2F)NC(=S)N1 |
| InChI | InChI=1S/C18H13F3N4O3S/c1-8-15(17(26)23-10-4-2-3-9(19)5-10)16(24-18(29)22-8)11-6-14(25(27)28)13(21)7-12(11)20/h2-7,16H,1H3,(H,23,26)(H2,22,24,29) |
| InChIKey | BDDKXKDFHLHWGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|