C19H20F2N2O2 — CID 78893807
1-[5-fluoro-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-2-hydroxyphenyl]ethanone (PubChem CID 78893807) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[5-fluoro-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[5-fluoro-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 78893807 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[5-fluoro-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(F)cc(CN2CCN(c3ccccc3F)CC2)c1O |
| InChI | InChI=1S/C19H20F2N2O2/c1-13(24)16-11-15(20)10-14(19(16)25)12-22-6-8-23(9-7-22)18-5-3-2-4-17(18)21/h2-5,10-11,25H,6-9,12H2,1H3 |
| InChIKey | UPUNNMSMOHBSDY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|