About [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate
[4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 78894801) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate.
Molecular Properties
| Compound Name | [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
| PubChem CID | 78894801 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)CCCN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-4-18(2,3)13-7-9-14(10-8-13)24-16(22)6-5-11-20-15(21)12-19-17(20)23/h7-10H,4-6,11-12H2,1-3H3,(H,19,23) |
| InChIKey | CHFFFPHUFBOVIA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate?
The IUPAC name of [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate (CID 78894801) is [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate.
What is the SMILES notation for [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate?
The canonical SMILES for [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate is CCC(C)(C)c1ccc(OC(=O)CCCN2C(=O)CNC2=O)cc1.
What is the InChIKey of [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate?
The InChIKey is CHFFFPHUFBOVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-4-18(2,3)13-7-9-14(10-8-13)24-16(22)6-5-11-20-15(21)12-19-17(20)23/h7-10H,4-6,11-12H2,1-3H3,(H,19,23).
What are the key properties of [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate?
[4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate has a molecular weight of 332.40 g/mol, XLogP of 2.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylbutan-2-yl)phenyl] 4-(2,5-dioxoimidazolidin-1-yl)butanoate is sourced from PubChem (CID 78894801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).