C20H19ClFN3O2 — CID 78894861
N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 78894861) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 78894861 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H19ClFN3O2/c1-13-17(11-23-16-6-7-18-19(10-16)27-9-8-26-18)20(21)25(24-13)12-14-2-4-15(22)5-3-14/h2-7,10,23H,8-9,11-12H2,1H3 |
| InChIKey | ARMKDDVHMPLABL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|