C9H10Cl2N2O4S — CID 78895747
2,2-dichloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]cyclopropane-1-carboxamide (PubChem CID 78895747) has the molecular formula C9H10Cl2N2O4S and a molecular weight of 313.16 g/mol. Its IUPAC name is 2,2-dichloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78895747 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 2,2-dichloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]cyclopropane-1-carboxamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-4-7(5(2)17-12-4)18(15,16)13-8(14)6-3-9(6,10)11/h6H,3H2,1-2H3,(H,13,14) |
| InChIKey | VQOGYASMPGQZJC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|