C15H26N2 — CID 78896115
N,2-diethyl-N-(2-pyridin-4-ylethyl)butan-1-amine (PubChem CID 78896115) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N,2-diethyl-N-(2-pyridin-4-ylethyl)butan-1-amine.
| Compound Name | N,2-diethyl-N-(2-pyridin-4-ylethyl)butan-1-amine |
|---|---|
| PubChem CID | 78896115 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,2-diethyl-N-(2-pyridin-4-ylethyl)butan-1-amine |
| SMILES | CCC(CC)CN(CC)CCc1ccncc1 |
| InChI | InChI=1S/C15H26N2/c1-4-14(5-2)13-17(6-3)12-9-15-7-10-16-11-8-15/h7-8,10-11,14H,4-6,9,12-13H2,1-3H3 |
| InChIKey | AUSWQMYQYDLYQX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |