C22H25N5O4 — CID 78897377
1-[2-[4-(2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3,4-dihydro-2H-quinoline-5-carboxamide (PubChem CID 78897377) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[2-[4-(2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3,4-dihydro-2H-quinoline-5-carboxamide.
| Compound Name | 1-[2-[4-(2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3,4-dihydro-2H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 78897377 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[2-[4-(2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3,4-dihydro-2H-quinoline-5-carboxamide |
| SMILES | NC(=O)c1cccc2c1CCCN2CC(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H25N5O4/c23-22(29)17-5-3-9-18-16(17)6-4-10-26(18)15-21(28)25-13-11-24(12-14-25)19-7-1-2-8-20(19)27(30)31/h1-3,5,7-9H,4,6,10-15H2,(H2,23,29) |
| InChIKey | WZNPYLYIFMVBIL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|