C16H21Cl2N3O3 — CID 78900590
ethyl N-[1-[2-(2,4-dichloroanilino)-2-oxoethyl]piperidin-3-yl]carbamate (PubChem CID 78900590) has the molecular formula C16H21Cl2N3O3 and a molecular weight of 374.27 g/mol. Its IUPAC name is ethyl N-[1-[2-(2,4-dichloroanilino)-2-oxoethyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(2,4-dichloroanilino)-2-oxoethyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 78900590 |
| Molecular Formula | C16H21Cl2N3O3 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | ethyl N-[1-[2-(2,4-dichloroanilino)-2-oxoethyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(CC(=O)Nc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H21Cl2N3O3/c1-2-24-16(23)19-12-4-3-7-21(9-12)10-15(22)20-14-6-5-11(17)8-13(14)18/h5-6,8,12H,2-4,7,9-10H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | OSKQBEGPGZPVDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |