C21H22ClN5OS — CID 78902164
1-(4-chlorophenyl)-5-methyl-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 78902164) has the molecular formula C21H22ClN5OS and a molecular weight of 427.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 78902164 |
| Molecular Formula | C21H22ClN5OS |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCc2ccc(N3CCSCC3)cc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN5OS/c1-15-24-20(25-27(15)19-8-4-17(22)5-9-19)21(28)23-14-16-2-6-18(7-3-16)26-10-12-29-13-11-26/h2-9H,10-14H2,1H3,(H,23,28) |
| InChIKey | SHWFPBFVQAHCMC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|