C19H24N2O3 — CID 78903073
N-(3,4-dimethoxyphenyl)-2-(N,2,4-trimethylanilino)acetamide (PubChem CID 78903073) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(N,2,4-trimethylanilino)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(N,2,4-trimethylanilino)acetamide |
|---|---|
| PubChem CID | 78903073 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(N,2,4-trimethylanilino)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)c2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-13-6-8-16(14(2)10-13)21(3)12-19(22)20-15-7-9-17(23-4)18(11-15)24-5/h6-11H,12H2,1-5H3,(H,20,22) |
| InChIKey | DKYUSAJDNMOYDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |