C21H21N5O2S2 — CID 78903153
N-(2-cyanoethyl)-N-(2,3-dimethylphenyl)-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide (PubChem CID 78903153) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(2,3-dimethylphenyl)-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-(2,3-dimethylphenyl)-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 78903153 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-(2-cyanoethyl)-N-(2,3-dimethylphenyl)-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CC(=O)N(CCC#N)c3cccc(C)c3C)cnc21 |
| InChI | InChI=1S/C21H21N5O2S2/c1-4-10-26-19-18(30-21(26)29)20(28)24(13-23-19)12-17(27)25(11-6-9-22)16-8-5-7-14(2)15(16)3/h4-5,7-8,13H,1,6,10-12H2,2-3H3 |
| InChIKey | GIXMFAPYHFAFCA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|