C18H21FN2O — CID 78903764
2-(N-ethyl-2,4-dimethylanilino)-N-(2-fluorophenyl)acetamide (PubChem CID 78903764) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(N-ethyl-2,4-dimethylanilino)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(N-ethyl-2,4-dimethylanilino)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 78903764 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-(N-ethyl-2,4-dimethylanilino)-N-(2-fluorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1F)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H21FN2O/c1-4-21(17-10-9-13(2)11-14(17)3)12-18(22)20-16-8-6-5-7-15(16)19/h5-11H,4,12H2,1-3H3,(H,20,22) |
| InChIKey | RLHMNPDKAAOZNZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |