C19H29NO3 — CID 78903776
[1-(2-hydroxy-3-propan-2-yloxypropyl)piperidin-4-yl]-(4-methylphenyl)methanone (PubChem CID 78903776) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is [1-(2-hydroxy-3-propan-2-yloxypropyl)piperidin-4-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-(2-hydroxy-3-propan-2-yloxypropyl)piperidin-4-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 78903776 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | [1-(2-hydroxy-3-propan-2-yloxypropyl)piperidin-4-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(CC(O)COC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29NO3/c1-14(2)23-13-18(21)12-20-10-8-17(9-11-20)19(22)16-6-4-15(3)5-7-16/h4-7,14,17-18,21H,8-13H2,1-3H3 |
| InChIKey | VSJGNGXHVQECFA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |