C15H23NO4S — CID 78907308
methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoate (PubChem CID 78907308) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 78907308 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C15H23NO4S/c1-11-6-7-12(15(2,3)4)10-13(11)21(18,19)16-9-8-14(17)20-5/h6-7,10,16H,8-9H2,1-5H3 |
| InChIKey | GXFUBLNFPBTHGG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |