About (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide
(E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide (PubChem CID 78907893) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide |
| PubChem CID | 78907893 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)NN1C(C)CCCC1C |
| InChI | InChI=1S/C11H20N2O/c1-4-6-11(14)12-13-9(2)7-5-8-10(13)3/h4,6,9-10H,5,7-8H2,1-3H3,(H,12,14)/b6-4+ |
| InChIKey | NDXCUPHEUZOSHL-GQCTYLIASA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide?
The IUPAC name of (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide (CID 78907893) is (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide.
What is the SMILES notation for (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide?
The canonical SMILES for (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide is C/C=C/C(=O)NN1C(C)CCCC1C.
What is the InChIKey of (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide?
The InChIKey is NDXCUPHEUZOSHL-GQCTYLIASA-N. The full InChI is InChI=1S/C11H20N2O/c1-4-6-11(14)12-13-9(2)7-5-8-10(13)3/h4,6,9-10H,5,7-8H2,1-3H3,(H,12,14)/b6-4+.
What are the key properties of (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide?
(E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide has a molecular weight of 196.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,6-dimethylpiperidin-1-yl)but-2-enamide is sourced from PubChem (CID 78907893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).