C16H18N2 — CID 78909075
N-naphthalen-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 78909075) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-naphthalen-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-naphthalen-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 78909075 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-naphthalen-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | c1ccc2c(NC3=NCCCCC3)cccc2c1 |
| InChI | InChI=1S/C16H18N2/c1-2-11-16(17-12-5-1)18-15-10-6-8-13-7-3-4-9-14(13)15/h3-4,6-10H,1-2,5,11-12H2,(H,17,18) |
| InChIKey | JHHOODVOFSFZFA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |