About [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate (PubChem CID 7890955) has the molecular formula C15H14ClNO4S
and a molecular weight of 339.80 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate |
| PubChem CID | 7890955 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-20-13-5-4-10(16)7-12(13)17-14(18)9-21-15(19)8-11-3-2-6-22-11/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | AUKGWMLXIWDJTA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate?
The IUPAC name of [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate (CID 7890955) is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate.
What is the SMILES notation for [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate?
The canonical SMILES for [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate is COc1ccc(Cl)cc1NC(=O)COC(=O)Cc1cccs1.
What is the InChIKey of [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate?
The InChIKey is AUKGWMLXIWDJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO4S/c1-20-13-5-4-10(16)7-12(13)17-14(18)9-21-15(19)8-11-3-2-6-22-11/h2-7H,8-9H2,1H3,(H,17,18).
What are the key properties of [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate?
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate has a molecular weight of 339.80 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-thiophen-2-ylacetate is sourced from PubChem (CID 7890955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).