C13H24ClNO3S — CID 78910750
N-(4-chloro-1,1-dioxothiolan-3-yl)-3,5,5-trimethylhexanamide (PubChem CID 78910750) has the molecular formula C13H24ClNO3S and a molecular weight of 309.86 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 78910750 |
| Molecular Formula | C13H24ClNO3S |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NC1CS(=O)(=O)CC1Cl)CC(C)(C)C |
| InChI | InChI=1S/C13H24ClNO3S/c1-9(6-13(2,3)4)5-12(16)15-11-8-19(17,18)7-10(11)14/h9-11H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | KTLNUARRJFZHDT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|