About (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone
(3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 789110) has the molecular formula C16H14BrNO
and a molecular weight of 316.20 g/mol. Its IUPAC name is (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| PubChem CID | 789110 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H14BrNO/c17-14-8-3-6-13(11-14)16(19)18-10-4-7-12-5-1-2-9-15(12)18/h1-3,5-6,8-9,11H,4,7,10H2 |
| InChIKey | XPHRMLJSTGXJCS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone?
The IUPAC name of (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (CID 789110) is (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone.
What is the SMILES notation for (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone?
The canonical SMILES for (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone is O=C(c1cccc(Br)c1)N1CCCc2ccccc21.
What is the InChIKey of (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone?
The InChIKey is XPHRMLJSTGXJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO/c17-14-8-3-6-13(11-14)16(19)18-10-4-7-12-5-1-2-9-15(12)18/h1-3,5-6,8-9,11H,4,7,10H2.
What are the key properties of (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone?
(3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone has a molecular weight of 316.20 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone is sourced from PubChem (CID 789110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).