About 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile
2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile (PubChem CID 78911034) has the molecular formula C14H12FN3S
and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile |
| PubChem CID | 78911034 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile |
| SMILES | Cc1nc(Sc2cccc(F)c2C#N)nc(C)c1C |
| InChI | InChI=1S/C14H12FN3S/c1-8-9(2)17-14(18-10(8)3)19-13-6-4-5-12(15)11(13)7-16/h4-6H,1-3H3 |
| InChIKey | XXNDIILMUNDYPU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile?
The IUPAC name of 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile (CID 78911034) is 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile.
What is the SMILES notation for 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile?
The canonical SMILES for 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile is Cc1nc(Sc2cccc(F)c2C#N)nc(C)c1C.
What is the InChIKey of 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile?
The InChIKey is XXNDIILMUNDYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3S/c1-8-9(2)17-14(18-10(8)3)19-13-6-4-5-12(15)11(13)7-16/h4-6H,1-3H3.
What are the key properties of 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile?
2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile has a molecular weight of 273.34 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzonitrile is sourced from PubChem (CID 78911034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).