About 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol
1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol (PubChem CID 78912068) has the molecular formula C9H16N2O2S3
and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol |
| PubChem CID | 78912068 |
| Molecular Formula | C9H16N2O2S3 |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CSc1nnc(SCC(O)COC(C)C)s1 |
| InChI | InChI=1S/C9H16N2O2S3/c1-6(2)13-4-7(12)5-15-9-11-10-8(14-3)16-9/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | ASLVECOFWSJWNO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol?
The IUPAC name of 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol (CID 78912068) is 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol.
What is the SMILES notation for 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol?
The canonical SMILES for 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol is CSc1nnc(SCC(O)COC(C)C)s1.
What is the InChIKey of 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol?
The InChIKey is ASLVECOFWSJWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S3/c1-6(2)13-4-7(12)5-15-9-11-10-8(14-3)16-9/h6-7,12H,4-5H2,1-3H3.
What are the key properties of 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol?
1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol has a molecular weight of 280.44 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol is sourced from PubChem (CID 78912068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).