About N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline (PubChem CID 78912513) has the molecular formula C14H12ClN3
and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline |
| PubChem CID | 78912513 |
| Molecular Formula | C14H12ClN3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline |
| SMILES | Clc1ccc2nc(CNc3ccccc3)cn2c1 |
| InChI | InChI=1S/C14H12ClN3/c15-11-6-7-14-17-13(10-18(14)9-11)8-16-12-4-2-1-3-5-12/h1-7,9-10,16H,8H2 |
| InChIKey | UIWIPTRIJPRABW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The IUPAC name of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline (CID 78912513) is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline.
What is the SMILES notation for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The canonical SMILES for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline is Clc1ccc2nc(CNc3ccccc3)cn2c1.
What is the InChIKey of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The InChIKey is UIWIPTRIJPRABW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3/c15-11-6-7-14-17-13(10-18(14)9-11)8-16-12-4-2-1-3-5-12/h1-7,9-10,16H,8H2.
What are the key properties of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline has a molecular weight of 257.72 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]aniline is sourced from PubChem (CID 78912513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).