C12H21N3O4 — CID 78912886
ethyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]piperidine-2-carboxylate (PubChem CID 78912886) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 78912886 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | ethyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H21N3O4/c1-3-19-11(17)9-6-4-5-7-15(9)8(2)10(16)14-12(13)18/h8-9H,3-7H2,1-2H3,(H3,13,14,16,18) |
| InChIKey | URVWMRZQYPSRPD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |