C16H15Cl2N3 — CID 78913569
N-(1H-benzimidazol-2-ylmethyl)-1-(2,4-dichlorophenyl)ethanamine (PubChem CID 78913569) has the molecular formula C16H15Cl2N3 and a molecular weight of 320.22 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 78913569 |
| Molecular Formula | C16H15Cl2N3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1-(2,4-dichlorophenyl)ethanamine |
| SMILES | CC(NCc1nc2ccccc2[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N3/c1-10(12-7-6-11(17)8-13(12)18)19-9-16-20-14-4-2-3-5-15(14)21-16/h2-8,10,19H,9H2,1H3,(H,20,21) |
| InChIKey | HZKUGWKGOHRWHW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |