C13H15NO2 — CID 78913723
5-[(2,6-dimethylphenoxy)methyl]-3-methyl-1,2-oxazole (PubChem CID 78913723) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenoxy)methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[(2,6-dimethylphenoxy)methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 78913723 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 5-[(2,6-dimethylphenoxy)methyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(COc2c(C)cccc2C)on1 |
| InChI | InChI=1S/C13H15NO2/c1-9-5-4-6-10(2)13(9)15-8-12-7-11(3)14-16-12/h4-7H,8H2,1-3H3 |
| InChIKey | LJWDWFYHLYIWCD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |