C15H16N2O3 — CID 78915168
N,N-bis(furan-2-ylmethyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 78915168) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N,N-bis(furan-2-ylmethyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N,N-bis(furan-2-ylmethyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 78915168 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N,N-bis(furan-2-ylmethyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C15H16N2O3/c1-2-7-16-10-15(18)17(11-13-5-3-8-19-13)12-14-6-4-9-20-14/h1,3-6,8-9,16H,7,10-12H2 |
| InChIKey | PNLYAZVRXJCYLP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|