C14H17N3S2 — CID 78915210
4-cyclopropyl-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 78915210) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-cyclopropyl-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopropyl-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 78915210 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-cyclopropyl-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc3c(s2)CCCCC3)n1C1CC1 |
| InChI | InChI=1S/C14H17N3S2/c18-14-16-15-13(17(14)10-6-7-10)12-8-9-4-2-1-3-5-11(9)19-12/h8,10H,1-7H2,(H,16,18) |
| InChIKey | DAJZSSDIVLKLOW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|