C21H18ClNO4 — CID 7891534
[2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7891534) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7891534 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc2ccccc2cc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO4/c1-13(14-6-8-17(22)9-7-14)23-20(25)12-27-21(26)18-10-15-4-2-3-5-16(15)11-19(18)24/h2-11,13,24H,12H2,1H3,(H,23,25)/t13-/m1/s1 |
| InChIKey | ZWIVFZUMYWAIIK-CYBMUJFWSA-N |
| XLogP | 4.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |