3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid

C7H10N2O4 — CID 78915419

IUPAC3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid
SMILESCN1C(=O)NC(CCC(=O)O)C1=O
InChIInChI=1S/C7H10N2O4/c1-9-6(12)4(8-7(9)13)2-3-5(10)11/h4H,2-3H2,1H3,(H,8,13)(H,10,11)
InChIKeyJUAGQDXHOXEGKN-UHFFFAOYSA-N
MW186.17 g/mol
LogP-0.60
Rot. Bonds3

About 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid

3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid (PubChem CID 78915419) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid
PubChem CID78915419
Molecular FormulaC7H10N2O4
Molecular Weight186.17 g/mol
Exact Mass186.06
IUPAC Name3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid
SMILESCN1C(=O)NC(CCC(=O)O)C1=O
InChIInChI=1S/C7H10N2O4/c1-9-6(12)4(8-7(9)13)2-3-5(10)11/h4H,2-3H2,1H3,(H,8,13)(H,10,11)
InChIKeyJUAGQDXHOXEGKN-UHFFFAOYSA-N
XLogP-0.60
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.17
LogP ≤ 5-0.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid?
The IUPAC name of 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid (CID 78915419) is 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid.
What is the SMILES notation for 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid?
The canonical SMILES for 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid is CN1C(=O)NC(CCC(=O)O)C1=O.
What is the InChIKey of 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid?
The InChIKey is JUAGQDXHOXEGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-9-6(12)4(8-7(9)13)2-3-5(10)11/h4H,2-3H2,1H3,(H,8,13)(H,10,11).
What are the key properties of 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid?
3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid has a molecular weight of 186.17 g/mol, XLogP of -0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-2,5-dioxoimidazolidin-4-yl)propanoic acid is sourced from PubChem (CID 78915419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).