C15H21NO4S — CID 78915809
2-[prop-2-enyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]acetic acid (PubChem CID 78915809) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[prop-2-enyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[prop-2-enyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 78915809 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[prop-2-enyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C15H21NO4S/c1-6-7-16(9-14(17)18)21(19,20)15-12(4)10(2)8-11(3)13(15)5/h6,8H,1,7,9H2,2-5H3,(H,17,18) |
| InChIKey | JXIKHLVUVWMSHK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|