C16H22N2O2S — CID 78915843
N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]adamantane-2-carboxamide (PubChem CID 78915843) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]adamantane-2-carboxamide.
| Compound Name | N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 78915843 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]adamantane-2-carboxamide |
| SMILES | CC(O)c1csc(NC(=O)C2C3CC4CC(C3)CC2C4)n1 |
| InChI | InChI=1S/C16H22N2O2S/c1-8(19)13-7-21-16(17-13)18-15(20)14-11-3-9-2-10(5-11)6-12(14)4-9/h7-12,14,19H,2-6H2,1H3,(H,17,18,20) |
| InChIKey | TURNBMXUZJESRQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |