C13H11FO2S — CID 78917575
5-(4-fluoro-3-methylphenyl)-4-methylthiophene-2-carboxylic acid (PubChem CID 78917575) has the molecular formula C13H11FO2S and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(4-fluoro-3-methylphenyl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 78917575 |
| Molecular Formula | C13H11FO2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(-c2sc(C(=O)O)cc2C)ccc1F |
| InChI | InChI=1S/C13H11FO2S/c1-7-5-9(3-4-10(7)14)12-8(2)6-11(17-12)13(15)16/h3-6H,1-2H3,(H,15,16) |
| InChIKey | FVAVIWDTVVGLCH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |