About 4-chloro-N,N-dimethyl-2-nitrobenzamide
4-chloro-N,N-dimethyl-2-nitrobenzamide (PubChem CID 789186) has the molecular formula C9H9ClN2O3
and a molecular weight of 228.64 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-nitrobenzamide.
Molecular Properties
| Compound Name | 4-chloro-N,N-dimethyl-2-nitrobenzamide |
| PubChem CID | 789186 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-nitrobenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9ClN2O3/c1-11(2)9(13)7-4-3-6(10)5-8(7)12(14)15/h3-5H,1-2H3 |
| InChIKey | MNVUBOXXFMXSLP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N,N-dimethyl-2-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,N-dimethyl-2-nitrobenzamide?
The IUPAC name of 4-chloro-N,N-dimethyl-2-nitrobenzamide (CID 789186) is 4-chloro-N,N-dimethyl-2-nitrobenzamide.
What is the SMILES notation for 4-chloro-N,N-dimethyl-2-nitrobenzamide?
The canonical SMILES for 4-chloro-N,N-dimethyl-2-nitrobenzamide is CN(C)C(=O)c1ccc(Cl)cc1[N+](=O)[O-].
What is the InChIKey of 4-chloro-N,N-dimethyl-2-nitrobenzamide?
The InChIKey is MNVUBOXXFMXSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O3/c1-11(2)9(13)7-4-3-6(10)5-8(7)12(14)15/h3-5H,1-2H3.
What are the key properties of 4-chloro-N,N-dimethyl-2-nitrobenzamide?
4-chloro-N,N-dimethyl-2-nitrobenzamide has a molecular weight of 228.64 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,N-dimethyl-2-nitrobenzamide is sourced from PubChem (CID 789186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).