C13H20N2O4S — CID 78919504
methyl (3S)-1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-3-carboxylate (PubChem CID 78919504) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl (3S)-1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919504 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl (3S)-1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)CCN2CCSC2=O)C1 |
| InChI | InChI=1S/C13H20N2O4S/c1-19-12(17)10-3-2-5-15(9-10)11(16)4-6-14-7-8-20-13(14)18/h10H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | RVDMYCDRVINMRO-JTQLQIEISA-N |
| XLogP | 0.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|