About Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate
Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate (PubChem CID 789224) has the molecular formula C15H17Cl2NO3
and a molecular weight of 330.20 g/mol. Its IUPAC name is ethyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate |
| PubChem CID | 789224 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | ethyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C15H17Cl2NO3/c1-2-21-15(20)10-5-7-18(8-6-10)14(19)11-3-4-12(16)13(17)9-11/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | YGBMWNHTQVMKMU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 383 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate?
The IUPAC name of Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate (CID 789224) is ethyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate.
What is the SMILES notation for Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate?
The canonical SMILES for Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate is CCOC(=O)C1CCN(CC1)C(=O)C2=CC(=C(C=C2)Cl)Cl.
What is the InChIKey of Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate?
The InChIKey is YGBMWNHTQVMKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2NO3/c1-2-21-15(20)10-5-7-18(8-6-10)14(19)11-3-4-12(16)13(17)9-11/h3-4,9-10H,2,5-8H2,1H3.
What are the key properties of Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate?
Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate has a molecular weight of 330.20 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 1-(3,4-dichlorobenzoyl)-4-piperidinecarboxylate is sourced from PubChem (CID 789224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).