C11H8FNO2S — CID 78923588
(3-fluoro-4-methoxyphenyl)-(1,3-thiazol-4-yl)methanone (PubChem CID 78923588) has the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 78923588 |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-(1,3-thiazol-4-yl)methanone |
| SMILES | COc1ccc(C(=O)c2cscn2)cc1F |
| InChI | InChI=1S/C11H8FNO2S/c1-15-10-3-2-7(4-8(10)12)11(14)9-5-16-6-13-9/h2-6H,1H3 |
| InChIKey | OCEQQBAAWDGUQJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |