About phenyl(1,3-thiazol-4-yl)methanol
phenyl(1,3-thiazol-4-yl)methanol (PubChem CID 78923958) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is phenyl(1,3-thiazol-4-yl)methanol.
Molecular Properties
| Compound Name | phenyl(1,3-thiazol-4-yl)methanol |
| PubChem CID | 78923958 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | phenyl(1,3-thiazol-4-yl)methanol |
| SMILES | OC(c1ccccc1)c1cscn1 |
| InChI | InChI=1S/C10H9NOS/c12-10(9-6-13-7-11-9)8-4-2-1-3-5-8/h1-7,10,12H |
| InChIKey | DVYUNZJAAKAZSR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl(1,3-thiazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(1,3-thiazol-4-yl)methanol?
The IUPAC name of phenyl(1,3-thiazol-4-yl)methanol (CID 78923958) is phenyl(1,3-thiazol-4-yl)methanol.
What is the SMILES notation for phenyl(1,3-thiazol-4-yl)methanol?
The canonical SMILES for phenyl(1,3-thiazol-4-yl)methanol is OC(c1ccccc1)c1cscn1.
What is the InChIKey of phenyl(1,3-thiazol-4-yl)methanol?
The InChIKey is DVYUNZJAAKAZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c12-10(9-6-13-7-11-9)8-4-2-1-3-5-8/h1-7,10,12H.
What are the key properties of phenyl(1,3-thiazol-4-yl)methanol?
phenyl(1,3-thiazol-4-yl)methanol has a molecular weight of 191.25 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(1,3-thiazol-4-yl)methanol is sourced from PubChem (CID 78923958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).