About methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate
methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate (PubChem CID 78924255) has the molecular formula C12H21F3N2O3
and a molecular weight of 298.31 g/mol. Its IUPAC name is methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate |
| PubChem CID | 78924255 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O3/c1-9(2)7-17(5-4-11(19)20-3)10(18)6-16-8-12(13,14)15/h9,16H,4-8H2,1-3H3 |
| InChIKey | XVJJVUVWURTWHQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate?
The IUPAC name of methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate (CID 78924255) is methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate.
What is the SMILES notation for methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate?
The canonical SMILES for methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate is COC(=O)CCN(CC(C)C)C(=O)CNCC(F)(F)F.
What is the InChIKey of methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate?
The InChIKey is XVJJVUVWURTWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O3/c1-9(2)7-17(5-4-11(19)20-3)10(18)6-16-8-12(13,14)15/h9,16H,4-8H2,1-3H3.
What are the key properties of methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate?
methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate has a molecular weight of 298.31 g/mol, XLogP of 1.19, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-methylpropyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]propanoate is sourced from PubChem (CID 78924255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).