C13H19ClFNO — CID 78924376
1-(4-chloro-2-fluorophenyl)-N-ethyl-4-methoxybutan-1-amine (PubChem CID 78924376) has the molecular formula C13H19ClFNO and a molecular weight of 259.75 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-ethyl-4-methoxybutan-1-amine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-ethyl-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 78924376 |
| Molecular Formula | C13H19ClFNO |
| Molecular Weight | 259.75 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-ethyl-4-methoxybutan-1-amine |
| SMILES | CCNC(CCCOC)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H19ClFNO/c1-3-16-13(5-4-8-17-2)11-7-6-10(14)9-12(11)15/h6-7,9,13,16H,3-5,8H2,1-2H3 |
| InChIKey | QHLLNWSRBFYEQT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|