About 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate
3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate (PubChem CID 78924639) has the molecular formula C10H14F3NO4
and a molecular weight of 269.22 g/mol. Its IUPAC name is 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate.
Analyze 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate?
The IUPAC name of 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate (CID 78924639) is 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate.
What is the SMILES notation for 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate?
The canonical SMILES for 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate is COC(=O)C1CCCN(C(=O)OCC(F)(F)F)C1.
What is the InChIKey of 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate?
The InChIKey is ATYFDKFEUZAWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO4/c1-17-8(15)7-3-2-4-14(5-7)9(16)18-6-10(11,12)13/h7H,2-6H2,1H3.
What are the key properties of 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate?
3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate has a molecular weight of 269.22 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-methyl 1-O-(2,2,2-trifluoroethyl) piperidine-1,3-dicarboxylate is sourced from PubChem (CID 78924639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).