About methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate
methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate (PubChem CID 78925123) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate |
| PubChem CID | 78925123 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CCCC#N)n1 |
| InChI | InChI=1S/C8H10N4O2/c1-14-8(13)7-10-6-12(11-7)5-3-2-4-9/h6H,2-3,5H2,1H3 |
| InChIKey | QUJQCDWSESPMLO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate (CID 78925123) is methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate is COC(=O)c1ncn(CCCC#N)n1.
What is the InChIKey of methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate?
The InChIKey is QUJQCDWSESPMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-14-8(13)7-10-6-12(11-7)5-3-2-4-9/h6H,2-3,5H2,1H3.
What are the key properties of methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate?
methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate has a molecular weight of 194.19 g/mol, XLogP of 0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3-cyanopropyl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 78925123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).