C11H19N5O2 — CID 78927760
6-acetamido-N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide (PubChem CID 78927760) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 6-acetamido-N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide.
| Compound Name | 6-acetamido-N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 78927760 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 6-acetamido-N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H19N5O2/c1-8-13-11(16-15-8)14-10(18)6-4-3-5-7-12-9(2)17/h3-7H2,1-2H3,(H,12,17)(H2,13,14,15,16,18) |
| InChIKey | RTTRQZLBOPKERV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|