About N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide
N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide (PubChem CID 78927851) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide.
Molecular Properties
| Compound Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide |
| PubChem CID | 78927851 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1n[nH]c(C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-3-4-5-6-8(14)11-9-10-7(2)12-13-9/h3-6H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | LWSNLDFMOTVBGN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide?
The IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide (CID 78927851) is N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide.
What is the SMILES notation for N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide?
The canonical SMILES for N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide is CCCCCC(=O)Nc1n[nH]c(C)n1.
What is the InChIKey of N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide?
The InChIKey is LWSNLDFMOTVBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-3-4-5-6-8(14)11-9-10-7(2)12-13-9/h3-6H2,1-2H3,(H2,10,11,12,13,14).
What are the key properties of N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide?
N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide has a molecular weight of 196.25 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1H-1,2,4-triazol-3-yl)hexanamide is sourced from PubChem (CID 78927851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).