About N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide
N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 78928244) has the molecular formula C9H8N8OS
and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| PubChem CID | 78928244 |
| Molecular Formula | C9H8N8OS |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | Cc1nc(NC(=O)c2sccc2-n2cnnn2)n[nH]1 |
| InChI | InChI=1S/C9H8N8OS/c1-5-11-9(14-13-5)12-8(18)7-6(2-3-19-7)17-4-10-15-16-17/h2-4H,1H3,(H2,11,12,13,14,18) |
| InChIKey | SXSWQVOVSWPPAX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide?
The IUPAC name of N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (CID 78928244) is N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide?
The canonical SMILES for N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide is Cc1nc(NC(=O)c2sccc2-n2cnnn2)n[nH]1.
What is the InChIKey of N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide?
The InChIKey is SXSWQVOVSWPPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N8OS/c1-5-11-9(14-13-5)12-8(18)7-6(2-3-19-7)17-4-10-15-16-17/h2-4H,1H3,(H2,11,12,13,14,18).
What are the key properties of N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide?
N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide has a molecular weight of 276.29 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1H-1,2,4-triazol-3-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide is sourced from PubChem (CID 78928244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).