C13H16Cl3NO2 — CID 78928713
4-[[(2,3,6-trichlorophenyl)methylamino]methyl]oxan-4-ol (PubChem CID 78928713) has the molecular formula C13H16Cl3NO2 and a molecular weight of 324.64 g/mol. Its IUPAC name is 4-[[(2,3,6-trichlorophenyl)methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[(2,3,6-trichlorophenyl)methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 78928713 |
| Molecular Formula | C13H16Cl3NO2 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-[[(2,3,6-trichlorophenyl)methylamino]methyl]oxan-4-ol |
| SMILES | OC1(CNCc2c(Cl)ccc(Cl)c2Cl)CCOCC1 |
| InChI | InChI=1S/C13H16Cl3NO2/c14-10-1-2-11(15)12(16)9(10)7-17-8-13(18)3-5-19-6-4-13/h1-2,17-18H,3-8H2 |
| InChIKey | RDGSPIKXLYXTJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|