C15H13FN2O3 — CID 78929098
N-(2-fluorophenyl)-2-[(2-formyl-6-methyl-3-pyridinyl)oxy]acetamide (PubChem CID 78929098) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(2-formyl-6-methyl-3-pyridinyl)oxy]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(2-formyl-6-methyl-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 78929098 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(2-formyl-6-methyl-3-pyridinyl)oxy]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccccc2F)c(C=O)n1 |
| InChI | InChI=1S/C15H13FN2O3/c1-10-6-7-14(13(8-19)17-10)21-9-15(20)18-12-5-3-2-4-11(12)16/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | AARSOFWJPAZQKL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|