About 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol
4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol (PubChem CID 78929377) has the molecular formula C12H17N5O2
and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol |
| PubChem CID | 78929377 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol |
| SMILES | Cn1ncc2c(NCC3(O)CCOCC3)ncnc21 |
| InChI | InChI=1S/C12H17N5O2/c1-17-11-9(6-16-17)10(14-8-15-11)13-7-12(18)2-4-19-5-3-12/h6,8,18H,2-5,7H2,1H3,(H,13,14,15) |
| InChIKey | QXQAVAHEZPHCKW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol (CID 78929377) is 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol is Cn1ncc2c(NCC3(O)CCOCC3)ncnc21.
What is the InChIKey of 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol?
The InChIKey is QXQAVAHEZPHCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O2/c1-17-11-9(6-16-17)10(14-8-15-11)13-7-12(18)2-4-19-5-3-12/h6,8,18H,2-5,7H2,1H3,(H,13,14,15).
What are the key properties of 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol?
4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol has a molecular weight of 263.30 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol is sourced from PubChem (CID 78929377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).